共查询到20条相似文献,搜索用时 31 毫秒
1.
The two title compounds were prepared by direct reactions of the corresponding elements at high temperature. The structures were determined by single-crystal X-ray diffraction: K(10)NbInAs(6), monoclinic, P2(1)/n, Z = 2, a = 9.107(1) A, b = 8.2878(8) A, c = 15.139(1) A, beta = 91.112(9) degrees; K(9)Nb(2)As(6), monoclinic, P2(1)/c, Z = 2, a = 9.348(1) A, b = 9.113(1) A, c = 12.798(1) A, beta = 95.98(1) degrees. They contain isolated dimers made of edge-sharing tetrahedra of [NbAs(4)] and [InAs(4)] in the former, NbInAs(6)(10)(-), and only [NbAs(4)] in the latter, Nb(2)As(6)(9)(-). Magnetic measurements show that K(10)NbInAs(6) is diamagnetic, i.e., a d(0) transition-metal Zintl phase, while K(9)Nb(2)As(6) exhibits a Curie-Weiss behavior consistent with the presence of one unpaired electron. The latter defines K(9)Nb(2)As(6) as a mixed-valence (presumably of type III) transition-metal Zintl phase, only the third example of such phases. 相似文献
2.
Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6). 相似文献
3.
An alkali-metal sulfur reactive flux has been used to synthesize a series of quaternary rare-earth metal compounds. These include KLaP(2)S(6) (I), K(2)La(P(2)S(6))(1/2)(PS(4)) (II), K(3)La(PS(4))(2) (III), K(4)La(0.67)(PS(4))(2) (IV), K(9-x)La(1+x/3)(PS(4))(4) (x = 0.5) (V), K(4)Eu(PS(4))(2) (VI), and KEuPS(4) (VII). Compound I crystallizes in the monoclinic space group P2(1)/c with the cell parameters a = 11.963(12) A, b = 7.525(10) A, c = 11.389(14) A, beta = 109.88(4) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/n with a = 9.066(6) A, b = 6.793(3) A, c = 20.112(7) A, beta = 97.54(3) degrees, and Z = 4. Compound III crystallizes in the monoclinic space group P2(1)/c with a= 9.141(2) A, b = 17.056(4) A, c = 9.470(2) A, beta = 90.29(2) degrees, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ibam with a = 18.202(2) A, b = 8.7596(7) A, c = 9.7699(8) A, and Z = 4. Compound V crystallizes in the orthorhombic space group Ccca with a = 17.529(9) A, b = 36.43(3) A, c = 9.782(4) A, and Z = 8. Compound VI crystallizes in the orthorhombic space group Ibam with a = 18.29(5) A, b = 8.81(2) A, c= 9.741(10) A, and Z = 4. Compound VII crystallizes in the orthorhombic space group Pnma with a = 16.782(2) A, b = 6.6141(6) A, c = 6.5142(6) A, and Z = 4. The sulfur compounds are in most cases isostructural to their selenium counterparts. By controlling experimental conditions, these structures can be placed in quasi-quaternary phase diagrams, which show the reaction conditions necessary to obtain a particular thiophosphate anionic unit in the crystalline product. These structures have been characterized by Raman and IR spectroscopy and UV-vis diffuse reflectance optical band gap analysis. 相似文献
4.
The isostructural title compounds were prepared by direct reactions of the corresponding elements, and their structures were determined from single-crystal X-ray diffraction data in the monoclinic space group C2/m, Z = 2 (K5As4, a = 11.592(2) A, b = 5.2114(5) A, c = 10.383(3) A, beta = 113.42(1) degrees; K5Sb4, a = 12.319(1) A, b = 5.4866(4) A, c = 11.258(1) A, beta = 112.27(7) degrees; Rb5Sb4, a = 12.7803(9) A, b = 5.7518(4) A, c = 11.6310(8) A, beta = 113.701(1) degrees; K5Bi4, a = 12.517(2) A, b = 5.541(1) A, c = 11.625(2) A, beta = 111.46(1) degrees; Rb5Bi4, a = 12.945(4) A, b = 5.7851(9) A, c = 12.018(5) A, beta = 112.78(3) degrees; Cs5Bi4, a = 12.887(3) A, b = 6.323(1) A, c = 12.636(1) A, beta = 122.94(2) degrees). The compounds contain isolated and flat zigzag tetramers of Pn4(4-) (Pnictide (Pn) = As, Sb, Bi) with a conjugated pi-electron system of delocalized electrons. All six compounds are metallic ("metallic salts") and show temperature-independent (Pauli-like) paramagnetism due to a delocalized electron from the extra alkali-metal cation in the formula. At low temperatures (around 9.5 K) and low magnetic fields the bismuthides become superconducting. 相似文献
5.
Five new rare-earth metal polyselenophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: K(2)La(P(2)Se(6))(1/2)(PSe(4)) (I), K(3)La(PSe(4))(2) (II), K(4)La(0.67)(PSe(4))(2) (III), K(9-x)()La(1+)(x/3)(PSe(4))(4) (x = 0.5) (IV), and KEuPSe(4) (V). Compound I crystallizes in the monoclinic space group P2(1)/n with a = 9.4269(1) A, b = 7.2054(1) A, c = 21.0276(5) A, beta = 97.484(1) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/c with a = 9.5782(2) A, b = 17.6623(4) A, c = 9.9869(3) A, beta = 90.120(1) degrees, and Z = 4. Compound III crystallizes in the orthorhombic space group Ibam with a = 19.0962(2) A, b = 9.1408(1) A, c = 10.2588(2) A, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ccca with a = 18.2133(1) A, b = 38.0914(4) A, c = 10.2665(1) A, and Z = 8. Compound V crystallizes in the orthorhombic space group Pnma with a = 17.5156(11) A, b = 7.0126(5) A, c = 6.9015(4) A, and Z = 4. Optical band gap measurements show that compound V has an optical band gap of 1.88 eV. Solid-state Raman spectroscopy of compounds II-V shows the four normal vibrations expected for the (PSe(4))(3-) unit. The observation of compounds I-V in several reactions has allowed the creation of a quasi-quaternary phase diagram for potassium rare-earth-metal polyselenophosphates. This phase diagram can qualitatively be separated into three regions on the basis of the oxidation state of phosphorus in the crystalline products observed and takes the next step in designing solid-state compounds. 相似文献
6.
Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials. 相似文献
7.
Four europium group XIV chalcogenides have been synthesized using the reactive flux method: K(2)EuTSe(5) (I, II) and KEuTS(4) (III, IV) where T = Si, Ge. K(2)EuSiSe(5), I, crystallizes in the monoclinic space group P2(1)/c with cell parameters a = 11.669(3) A, b = 9.844(2) A, c = 8.917(2) A, beta = 91.583(5) degrees, and Z = 4. K(2)EuGeSe(5), II, crystallizes in the monoclinic space group P2(1)/c with cell parameters a = 11.8056(3) A, b = 9.9630(1) A, c = 8.9456(1) A, beta = 91.195(1) degrees, and Z = 4. Both K(2)EuSiSe(5) and K(2)EuGeSe(5) are semiconductors with optical band-gaps of approximately 2.00 and 1.84 eV, respectively. Raman spectroscopy shows vibrations from the (TSe(5))(4-) (T = Si, Ge) unit. KEuSiS(4), III, crystallizes in the monoclinic space group P2(1) with cell parameters a = 6.426(4) A, b = 6.582(5) A, c = 8.566(7) A, beta = 107.83(6) degrees, and Z = 2. KEuGeS(4), IV, crystallizes in the monoclinic space group P2(1) with cell parameters a = 6.510(2) A, b = 6.649(2) A, c = 8.603(3) A, beta = 107.80(2) degrees, and Z = 2. Band-gap analysis shows that both compounds are semiconductors with optical band-gaps of 1.72 and 1.71 eV, respectively. The Raman spectrum of KEuGeS(4) shows the vibrations of the (GeS(4))(4-) unit. Fluorescence spectroscopy confirms the presence of Eu(III) in III and IV instead of Eu(II) as in I and II. These four crystalline products were formed under equivalent stoichiometric reaction conditions. The fact that two different products are observed can be used to understand the relationship between the oxidative and reductive potentials within these flux reactions. 相似文献
8.
The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4. 相似文献
9.
The ternary alkali selenophosphates KPSe6 and RbPSe6 crystallize in the polar orthorhombic space group Pca2(1) with a = 11.7764(17) A, b = 6.8580(10) A, c = 11.4596(16) A, and Z = 4 for RbPSe6. CsPSe6 crystallizes in the monoclinic space group P2/n with a = 6.877(3) A, b = 12.713(4) A, c = 11.242(4) A, beta = 92.735(7) degrees, and Z = 4. All compounds feature the one-dimensional infinite chain of [PSe2(Se)4-], where each P atom is connected with Se4(2-) bridge. These compounds show reversible glass-crystal transition, and 31P NMR data suggest that crystallization and infinite [PSe(6-)] chain formation are coupled processes. 相似文献
10.
Ten 1:1 and 2:1 complexes of [Mn(CO)(3)](+) and [Re(CO)(3)](+) with [Nb(6)O(19)](8)(-) and [Ta(6)O(19)](8)(-) have been isolated as potassium salts in good yields and characterized by elemental analysis, (17)O NMR and infrared spectroscopy, and single-crystal X-ray structure determinations. Crystal data for 1 (t-Re(2)Ta(6)): empirical formula, K(4)Na(2)Re(2)C(6)Ta(6)O(35)H(20), monoclinic, space group, C2/m, a = 17.648(3) A, b = 10.056(1) A, c = 13.171(2) A, beta = 112.531(2) degrees, Z = 2. 2 (t-Re(2)Nb(6)): empirical formula, K(6)Re(2)C(6)Nb(6)O(38)H(26), monoclinic, space group, C2/m, a = 17.724(1) A, b = 10.0664(6) A, c = 13.1965(7) A, beta = 112.067(1) degrees, Z = 2. 3 (t-Mn(2)Nb(6)): empirical formula, K(6)Mn(2)C(6)Nb(6)O(37)H(24), monoclinic, space group, C2/m, a = 17.812(2) A, b = 10.098(1) A, c = 13.109(2) A, beta = 112.733(2) degrees, Z = 2. 4 (c-Mn(2)Nb(6)): empirical formula, K(6)Mn(2)C(6)Nb(6)O(50)H(50), triclinic, space group, P1, a = 10.2617(6) A, b = 13.4198(8) A, c = 21.411(1) A, alpha = 72.738(1) degrees, beta = 112.067(1) degrees, gamma = 83.501(1) degrees, Z = 2. 5 (c-Re(2)Nb(6)): empirical formula, K(6)Re(2)C(6)Nb(6)O(54)H(58), monoclinic, space group, P2(1)/c, a = 21.687(2) A, b = 10.3085(9) A, c = 26.780(2) A, beta = 108.787(1) degrees, Z = 4. The complexes contain M(CO)(3) groups attached to the surface bridging oxygen atoms of the hexametalate anions to yield structures of nominal C(3)(v)() (1:1), D(3)(d)() (trans 2:1), and C(2)(v)() (cis 2:1) symmetry. The syntheses are carried out in aqueous solution or by aqueous hydrothermal methods, and the complexes have remarkably high thermal, redox, and hydrolytic stabilities. The Re-containing compounds are stable to 400-450 degrees C, at which point CO loss occurs. The Mn compounds lose CO at temperatures above 200 degrees C. Cyclic voltammetry of all complexes in 0.1 M sodium acetate show no redox behavior, except an irreversible oxidation process at approximately 1.0 V vs. Ag/AgCl. In contrast to the parent hexametalate anions that are stable only in alkaline (pH >10) solution, the new complexes are stable, at least kinetically, between pH 4 and pEta approximately 12. 相似文献
11.
The compounds (Me4N)[A(M(SC(O)Ph)3)2] (A = K, M = Cd (2); A = Na, M = Hg (3); and A = K, M = Hg (4)) were synthesized by reacting the appropriate metal chloride with A+PhC(O)S- and Me4NCl in the ratios 1:3:1 and 2:6:1. The structures of these compounds were determined by single-crystal X-ray diffraction methods. All the compounds are isomorphous, isostructural, and crystallized in the space group P1 with Z = 1. Single-crystal data for 2: a = 106670(2) A, b = 111522(2) A, c = 119294(2) A, alpha = 71782(1) degrees, beta = 85208(1) degrees, gamma = 69418(1) degrees, V = 126140(4) A3, Dcalc = 1528 g cm-3. Single-crystal data for 3: a = 10840(2) A, b = 10946(4) A, c = 12006(3) A, alpha = 7218(2) degrees, beta = 8675(2) degrees, gamma = 6743(2) degrees, V = 12493(6) A3, Dcalc = 1756 g cm-3. Single-crystal data for 4: a = 104780(1) A, b = 112563(2) A, c = 119827(2) A, alpha = 71574(1) degrees, beta = 85084(1) degrees, gamma = 70705(1) degrees, V = 126523(3) A3, Dcalc = 1755 g cm-3. In the [A(M(SC(O)Ph)3)2]- anions, each M(II) atom is bonded to three thiobenzoate ligands through sulfur atoms, giving a trigonal planar MS3 geometry. The carbonyl oxygen atoms from the two [M(SC(O)Ph)3]- anions are bonded to the alkali metal atom, providing an octahedral environment. Solution metal NMR studies showed the concentration-dependent dissociation of the alkali metal ions in the trinuclear anions. 相似文献
12.
Five new d0 transition metal iodates, BaTi(IO3)6, LaTiO(IO3)5, Ba2VO2(IO3)4.(IO3), K2MoO2(IO3)4, and BaMoO2(IO3)4.H2O, have been synthesized by hydrothermal methods using Ba(OH)2.8H2O, La2O3, K2CO3, TiO2, V2O5, MoO3, and HIO3 as reagents. The structures of these compounds were determined by single-crystal X-ray diffraction. All of the reported materials have zero-dimensional or pseudo-one-dimensional crystal structures composed of MO6 (M = Ti4+, V5+, or Mo6+) octahedra connected to IO3 polyhedra. Infrared and Raman spectroscopy, thermogravimetric analysis, and UV-vis diffuse reflectance spectroscopy are also presented. Crystal data: BaTi(IO3)6, trigonal, space group R-3 (No. 148), with a = b = 11.4711(10) A, c = 11.1465(17) A, V = 1270.2(2) A3, and Z = 3; LaTiO(IO3)5, monoclinic, space group P2(1)/n (No. 14), with a = 7.4798(10) A, b = 18.065(2) A, c = 10.4843(14) A, beta = 91.742(2) degrees , V = 1416.0(3) A3, and Z = 4; Ba2VO2(IO3)4.(IO3), monoclinic, space group P2(1)/c (No. 14), with a = 7.5012(9) A, b = 33.032(4) A, c = 7.2150(9) A, beta = 116.612(2) degrees , V = 1598.3(3) A3, and Z = 4; K2MoO2(IO3)4, monoclinic, space group C2/c (No. 15), with a = 12.959(2) A, b = 6.0793(9) A, c = 17.748(3) A, beta = 102.410(4) degrees , V = 1365.5(4) A3, and Z = 4; BaMoO2(IO3)4.H(2)O, monoclinic, space group P2(1)/n (No. 14), with a = 13.3368(17) A, b = 5.6846(7) A, c = 18.405(2) A, beta = 103.636(2) degrees , V = 1356.0(3) A3, and Z = 4. 相似文献
13.
The synthesis and characterization of compounds of the type Hg[1-C(6)H(4)-2-C(H)=NC(6)H(5-n)R(n)](2)
Flower KR Howard VJ Naguthney S Pritchard RG Warren JE McGown AT 《Inorganic chemistry》2002,41(7):1907-1912
The organomercurial compounds Hg[1-C(6)H(4)-2-C(H)=NC(6)H(5-n)R(n)](2) (R = 4-NMe(2), 6a; 4-Me, 6b; 4-I, 6c; 4-NO(2), 6d; 2-(i)Pr, 6e; 2-Me, 6f; 2,6-(i)Pr(2), 6g; 2,6-Me(2), 6h) have been prepared in good overall yield from 2-bromobenzaldehyde. All of the compounds have been characterized by elemental analysis, (1)H NMR, (13)C[(1)H] NMR, and infrared spectroscopy. In addition, compounds 6a [C(30)H(30)HgN(4), triclinic, P, a = 6.20000(10) A, b = 9.2315(2) A, c = 10.9069(3) A, alpha = 85.8510(10) degrees, beta = 89.3570(10) degrees, gamma = 87.206(2) degrees, Z = 1], 6b [C(28)H(24)HgN(2), monoclinic, P2(1)/c, a = 12.8260(5) A, b = 14.0675(4) A, c = 6.1032(2) A, beta = 90.0990(10) degrees, Z = 2], 6g [C(38)H(44)HgN(2), triclinic, P, a = 8.2626(2) A, b = 9.8317(2) A, c = 11.8873(3) A, alpha = 103.6650(10) degrees, beta = 109.3350(10) degrees, gamma = 104.627(2) degrees, Z = 1], and 6h [C(30)H(28)HgN(2), monoclinic, P2(1)/c, a = 12.5307(2) A, b = 10.9852(2) A, c = 18.2112(2) A, beta = 104.0190(10) degrees, gamma = 87.206(2) degrees, Z = 4] have been characterized by low-temperature single-crystal X-ray diffraction studies, and two different molecular geometries about the central mercury atom have been observed; intramolecular contacts suggest a van der Waals radius for Hg of 2.1-2.2 A. 相似文献
14.
Single crystals of A2ThP3Se9 (A = K (I), Rb (II)) and Cs4Th2PsSe17 (III) form from the reaction of Th and P in a molten A2Se3/Se (A = K, Rb, Cs) flux at 750 degrees C for 100 h. Compound I crystallizes in the triclinic space group P1 (No. 2) with unit cell parameters a = 10.4582(5) A, b = 16.5384(8) A, c = 10.2245(5) A, alpha = 107.637(1); beta = 91.652(1); gamma = 90.343(1) degrees, and Z = 2. Compound II crystallizes in the triclinic space group P1 (No. 2) with the unit cell parameters a = 10.5369(5) A, b = 16.6914(8) A, c = 10.2864(5) A, alpha = 107.614(1) degrees, beta = 92.059(1) degrees, gamma = 90.409(1) degrees, and Z = 2. These structures consist of infinite chains of corner-sharing [Th2Se14] units linked by (P2Se6)4- anions in two directions to form a ribbonlike structure along the [100] direction. Compounds I and II are isostructural with the previously reported K2UP3Se9. Compound III crystallizes in the monoclinic space group P2(1)/c (No. 14) with unit cell parameters a = 10.238(1) A, b = 32.182(2) A, c = 10.749(1) A; beta = 95.832(1) degrees, and Z = 4. Cs4Th2P5Se17 consists of infinite chains of corner-sharing, polyhedral [Th2Se13] units that are also linked by (P2Se6)4- anions in the [100] and [010] directions to form a layered structure. The structure of III features an (Se2)2- anion that is bound eta 2 to Th(2) and eta 1 to Th(1). This anion influences the coordination sphere of the 9-coordinate Th(2) atom such that it is best described as bicapped trigonal prismatic where the eta 2-bound anion occupies one coordination site. The composition of III may be formulated as Cs4Th2(P2Se6)5/2(Se2) due to the presence of the (Se2)2- unit. Raman spectra for these compounds and their interpretation are reported. 相似文献
15.
Matthews CJ Thompson LK Parsons SR Xu Z Miller DO Heath SL 《Inorganic chemistry》2001,40(17):4448-4454
A series of trigonal bipyramidal pentanuclear complexes involving the alkoxo-diazine ligands poap and p3oap, containing the M(5)[mu-O](6) core is described, which form by a strict self-assembly process. [Co(5)(poap-H)(6)](ClO(4))(4).3H(2)O (1), [Mn(5)(poap-H)(6)](ClO(4))(4).3.5CH(3)OH.H(2)O (2), [Mn(5)(p3oap-H)(6)](ClO(4))(4).CH(3)CH(2)OH.3H(2)O (3), and [Zn(5)(poap-H)(6)](ClO(4))(4).2.5H(2)O (4) are homoleptic pentanuclear complexes, where there is an exact match between the coordination requirements of the five metal ions in the cluster, and the available coordination pockets in the polytopic ligand. [Zn(4)(poap)(poap-H)(3)(H(2)O)(4)] (NO(3))(5).1.5H(2)O (5) is a square [2 x 2] grid with a Zn(4)[mu-O](4) core, and appears to result from the presence of NO(3), which is thought to be a competing ligand in the self-assembly. X-ray structures are reported for 1, 4, and 5. 1 crystallized in the monoclinic system, space group P2(1)/n with a = 13.385(1) A, b = 25.797(2) A, c = 28.513(3) A, beta = 98.704(2) degrees, and Z = 4. 4 crystallized in the triclinic system, space group P1 with a = 13.0897(9) A, b = 18.889(1) A, c = 20.506(2) A, alpha = 87.116(1) degrees, beta = 74.280(2) degrees, gamma = 75.809(2) degrees, and Z = 2. 5 crystallized in the monoclinic system, space group P2(1)/n with a = 14.8222(7) A, b = 21.408(1) A, c = 21.6197(9) A, beta = 90.698(1) degrees, and Z = 4. Compounds 1-3 exhibit intramolecular antiferromagnetic coupling. 相似文献
16.
The secondary phosphine R(Me(2)NCH(2)-2-C(6)H(4))PH reacts with Bu(2)Mg to give the homoleptic complex Mg[PR(C(6)H(4)-2-CH(2)NMe(2))](2) (1) [R = CH(SiMe(3))(2)]. The analogous heavier alkaline earth metal complexes (THF)(n)Ae[PR(C(6)H(4)-2-CH(2)NMe(2))](2) [Ae = Ca (2), n = 0; Ae = Sr (3), Ba (4), n = 1] have been synthesized by metathesis reactions between K[PR(C(6)H(4)-2-CH(2)NMe(2))] and 0.5 equiv of the respective alkaline earth metal diiodide. Compounds 1-4 have been characterized by X-ray crystallography and multielement NMR spectroscopy. In the solid state, compounds 1-4 are monomeric, complexes 1 and 2 adopting a distorted tetrahedral geometry and complexes 3 and 4 adopting a distorted square pyramidal geometry (1: orthorhombic, P2(1)2(1)2(1), a = 11.413(3) A, b = 12.072(3) A, c = 32.620(11) A, Z = 4. 2: monoclinic, P2(1)/c, a = 9.5550(4) A, b = 17.4560(7) A, c = 24.5782(10) A, beta = 91.673(2) degrees, Z = 4. 3: monoclinic, C2/c, a = 15.0498(9) A, b = 13.0180(8) A, c = 24.3664(14) A, beta = 104.593(2) degrees, Z = 4. 4: monoclinic, C2/c, a = 15.2930(10) A, b = 13.0326(9) A, c = 24.6491(17) A, beta = 105.542(2) degrees, Z = 4). In toluene solution, compounds 2-4 are subject to dynamic processes which are attributed to a monomer-dimer equilibrium for which bridge-terminal exchange of the phosphanide ligands in the dimer may be frozen out at low temperatures. 相似文献
17.
The polyborates Cs(2)M(2)B(10)O(17) (M = Na, K) have been prepared and their structures determined by single-crystal X-ray diffraction methods. They crystallize in the monoclinic space group C2/c (Z = 8) with unit-cell parameters a = 21.643(3) ?, b = 6.558(2) ?, c = 11.072(2) ?, beta = 105.43(1) degrees, V = 1514.8(6) ?(3) for the Na compound and a = 22.547(9) ?, b = 6.614(2) ?, c = 11.288(4) ?, beta = 103.25 degrees, V = 1638.3(8) ?(3) for the K analogue. The new structural type contains a 2-dimensional borate matrix that is built from a complete condensation of the ring system B(5)O(11). The Cs atoms reside within the borate matrix, and the Na (K) atoms are placed between the thick Cs borate sheets. 相似文献
18.
Four new compounds, RbSiBiS(4), RbGeBiS(4), CsSiBiS(4), and CsGeBiS(4), have been synthesized by means of the reactive flux method. The isostructural compounds RbSiBiS(4), RbGeBiS(4), and CsGeBiS(4) crystallize in space group P2(1)/c of the monoclinic system with four formula units in cells of dimensions at 153 K of a = 6.4714(4) A, b = 6.7999(4) A, c = 17.9058(11) A, and beta = 108.856(1) degrees for RbSiBiS(4), a = 6.5864(4) A, b = 6.8559(4) A, c = 17.9810(12) A, and beta = 109.075(1) degrees for RbGeBiS(4), and a = 6.5474(4) A, b = 6.9282(4) A, c = 18.8875(11) A, and beta = 110.173(1) degrees for CsGeBiS(4). CsSiBiS(4) crystallizes in a different structure type in space group P2(1)/c of the monoclinic system with four formula units in a cell of dimensions at 153 K of a = 9.3351(7) A, b = 6.9313(5) A, c = 12.8115(10) A, and beta = 109.096(1) degrees. The two structure types are closely related and consist of [MBiS(4)(-)] (M = Si, Ge) layers separated by bicapped trigonal-prismatically coordinated alkali-metal atoms. In each, the M atom is coordinated to a tetrahedron of four S atoms and the Bi atom is coordinated to seven S atoms comprising five close S atoms at the corners of a square pyramid with Bi near the center of the basal plane and the sixth and seventh S atoms further away to complete a distorted monocapped trigonal prism. The optical band gaps of 2.23 eV for RbGeBiS(4) and 2.28 eV for CsGeBiS(4) were deduced from their diffuse reflectance spectra. From a band structure calculation, the optical absorption for RbGeBiS(4) originates from the [GeBiS(4)(-)] layer. The Ge 4p orbitals, Bi 6p orbitals, and S 3p orbitals are highly hybridized. 相似文献
19.
Several novel pentamethylcyclopentadienyl complexes of general formula [(C5Me5)IrL3][BF4]2 were prepared including the tris(solvent) precursors [(C5Me5)M(acetone)2(H2O)][BF4]2 (M = Rh, Ir) (1a,b). The X-ray molecular structures of 1a,b were determined at low temperature. Complexes 1a,b are isostructural, and both compounds crystallize in the monoclinic space group P2(1)/c with a = 10.157(3) A, b = 14.038(9) A, c = 16.335(2) A, beta = 99.73(2) degrees, and Z = 4 for 1a and with a = 10.107(9) A, b = 13.994(16) A, c = 15.996(34) A, beta = 99.61(12) degrees, and Z = 4 for 1b. The coordinated water molecule is hydrogen bonded to both BF4(-) anions. Reaction of 1a,b with pyridine (py) afforded the related tris(pyridine) complexes [(C5Me5)M(eta1-(N)-py)3][BF4]2 (M = Rh, Ir) (2a,b). Complex 2b was characterized by X-ray crystallography, monoclinic space group P2(1)/c with a = 8.665(3) A, b = 19.687(7) A, c = 18.408(5) A, beta = 94.17(3) degrees, and Z = 4. Moreover, we prepared the novel neutral compounds (C5Me5)M(eta2-NO3)(eta1-NO3) (M = Rh, Ir) (4a,b) where the anions are bonded to the metal center instead of a coordinating solvent as confirmed by X-ray study on the iridium complex 4b. The latter crystallizes in the orthorhombic space group Pcab with a = 13.032(4) A, b = 14.370(11) A, c = 14.839(18) A, and Z = 8. 相似文献
20.
Hess RF Gordon PL Tait CD Abney KD Dorhout PK 《Journal of the American Chemical Society》2002,124(7):1327-1333
The first quaternary plutonium metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: K(3)Pu(PS(4))(2) (I), KPuP(2)S(7) (II), RbPuP(2)S(7) (III), and CsPuP(2)S(7) (IV). All four compounds crystallize in the monoclinic space group P2(1)/c with Z = 4. Compound I has cell parameters of a = 9.157(1) A, b = 16.866(2) A, c = 9.538(1), and beta = 90.610(3)degrees. Compound II has cell parameters of a = 9.641(1) A, b = 12.255(1) A, c = 9.015(1) A, and beta = 90.218(1)degrees. Compound III has cell parameters of a = 9.8011(6) A, b = 12.3977(7) A, c = 9.0263(5) A, and beta = 90.564(1)degrees. Compound IV has cell parameters of a = 10.1034(7) A, b = 12.5412(9) A, c = 9.0306(6) A, and beta = 91.007(1)degrees. Compound I is isostructural to a family of rare-earth metal thiophosphates and comprises bicapped trigonal prismatic PuS(8) polyhedra linked in chains through edge-sharing interactions and through thiophosphate tetrahedra. Compounds II-IV crystallize in a known structure type not related to any previously observed actinide thiophosphates and contain the (P(2)S(7))(4-) corner-shared bitetrahedral ligand as a structural building block. A summary of important bond distances and angles for these new plutonium thiophosphate materials is compared to the limited literature on plutonium solid-state compounds. Diffuse reflectance spectra confirm the Pu(III) oxidation state and Raman spectroscopy confirms the tetrahedral PS(4)(3-) building block in all structures. 相似文献