Niobium-arsenic Zintl phases: A(6)NbAs(5) (A = K,Rb, Cs), K(6)NbTlAs(4), and K(8)NbPbAs(5) with edge-bridged niobium-centered tetrahedra of arsenic, [NbAs(4)M](n-) where M = As,Tl, Pb

The five title compounds were prepared by direct reactions of the corresponding elements at high temperature. Their structures contain isolated anions of tetrahedral NbAs(4) where one of the edges of the tetrahedron is bridged by a third atom. The bridging atom is arsenic in A(6)NbAs(5) (monoclinic, P2(1)/c, Z = 8; with a = 25.774(3) A, b = 9.335(1) A, c = 13.012(1) A, beta = 101.05(1) degrees for A = K; a = 27.629(1) A, b = 9.925(1) A, c = 14.111(1) A, beta = 101.63(1) degrees for A = Rb; and a = 27.405(1) A, b = 9.9447(6) A, c = 13.9964(8) A, beta = 101.210(1) degrees for A = Cs), thallium in K(6)NbTlAs(4) (orthorhombic, Pnma, Z = 4, a = 18.786(1) A, b = 10.4442(4) A, c = 7.715(1) A), and lead in K(8)NbPbAs(5) (monoclinic, C2/c, Z = 8, a = 31.597(9) A, b = 9.353(1) A, c = 13.427(2) A, beta = 95.25(1) degrees ). The lead atom in the latter is bonded to a third arsenic atom as well. Magnetic measurements showed diamagnetic behavior, and therefore, the compounds are electronically balanced, closed-shell type compounds and can be described as transition-metal Zintl phases. The bonding in the anion NbAs(5)(6-) is discussed in detail.     

Application of equation-of-motion coupled-cluster methods to low-lying singlet and triplet electronic states of HBO and BOH

The equilibrium structures and physical properties of the X (1)sigma(+) linear electronic states, linear excited singlet and triplet electronic states of hydroboron monoxide (HBO) (A (1)sigma(-), B (1)delta, a (3)sigma(+), and b (3)delta) and boron hydroxide (BOH) (A (1)sigma(+), B (1)Pi, and b (3)Pi), and their bent counterparts (HBO a (3)A('), b (3)A("), A (1)A("), B (1)A(') and BOH X (1)A('), b (3)A('), c (3)A("), A (1)A('), B (1)A('), C (1)A(")) are investigated using excited electronic state ab initio equation-of-motion coupled-cluster (EOM-CC) methods. A new implementation of open-shell EOM-CC including iterative partial triple excitations (EOM-CC3) was tested. Coupled-cluster wave functions with single and double excitations (CCSD), single, double, and iterative partial triple excitations (CC3), and single, double, and full triple excitations (CCSDT) are employed with the correlation-consistent quadruple and quintuple zeta basis sets. The linear HBO X (1)sigma(+) state is predicted to lie 48.3 kcal mol(-1) (2.09 eV) lower in energy than the BOH X (1)sigma(+) linear stationary point at the CCSDT level of theory. The CCSDT BOH barrier to linearity is predicted to lie 3.7 kcal mol(-1) (0.16 eV). With a harmonic zero-point vibrational energy correction, the HBO X (1)sigma(+)-BOH X (1)A(') energy difference is 45.2 kcal mol(-1) (1.96 eV). The lowest triplet excited electronic state of HBO, a (3)A('), has a predicted excitation energy (T(e)) of 115 kcal mol(-1) (4.97 eV) from the HBO ground state minimum, while the lowest-bound BOH excited electronic state, b (3)A('), has a T(e) of 70.2 kcal mol(-1) (3.04 eV) with respect to BOH X (1)A('). The T(e) values predicted for the lowest singlet excited states are A (1)A(")<--X (1)sigma(+)=139 kcal mol(-1) (6.01 eV) for HBO and A (1)A(')<--X (1)A(')=102 kcal mol(-1) (4.42 eV) for BOH. Also for BOH, the triplet vertical transition energies are b (3)A(')<--X (1)A(')=71.4 kcal mol(-1) (3.10 eV) and c (3)A(")<--X (1)A(')=87.2 kcal mol(-1) (3.78 eV).     

Pillared layered structures based upon M(III) ethylene diphosphonates: the synthesis and crystal structures of M(III)(H(2)O)(HO(3)P(CH(2))(2)PO(3)) (M = Fe, Al, Ga)

A three-dimensional iron(III) diphosphonate, Fe(III)(H(2)O)(HO(3)P(CH(2))(2)PO(3)), I, has been synthesized hydrothermally and characterized by single-crystal X-ray diffraction. The compound crystallizes in the orthorhombic space group Pbca (no. 61) where a = 9.739(5) A, b = 9.498(5) A, c = 15.940(8) A, V = 1474.4(1) A(3), Z = 8, and R(1) = 0.0380. The structure consists of inorganic sheets pillared by the 1,2-ethylenediphosphonate groups. The sheets are composed of Fe(H(2)O)O(5) octahedra connected through PO(3)C tetrahedra. The corresponding isostructural aluminum (II) and gallium (III) compounds were also synthesized and indexed: II, a = 9.534(1) A, b = 9.255(2) A, c = 15.724(1) A, V = 1387.5(1) A(3); III, a = 9.670(1) A, b = 9.357(2) A, c = 15.862(4) A, V = 1435.4(1) A(3).     

Synthesis and characterization of the "metallic salts" A5Pn4 (A = K, Rb, Cs and Pn = As, Sb, Bi) with isolated zigzag tetramers of Pn4(4-) and an extra delocalized electron

The isostructural title compounds were prepared by direct reactions of the corresponding elements, and their structures were determined from single-crystal X-ray diffraction data in the monoclinic space group C2/m, Z = 2 (K5As4, a = 11.592(2) A, b = 5.2114(5) A, c = 10.383(3) A, beta = 113.42(1) degrees; K5Sb4, a = 12.319(1) A, b = 5.4866(4) A, c = 11.258(1) A, beta = 112.27(7) degrees; Rb5Sb4, a = 12.7803(9) A, b = 5.7518(4) A, c = 11.6310(8) A, beta = 113.701(1) degrees; K5Bi4, a = 12.517(2) A, b = 5.541(1) A, c = 11.625(2) A, beta = 111.46(1) degrees; Rb5Bi4, a = 12.945(4) A, b = 5.7851(9) A, c = 12.018(5) A, beta = 112.78(3) degrees; Cs5Bi4, a = 12.887(3) A, b = 6.323(1) A, c = 12.636(1) A, beta = 122.94(2) degrees). The compounds contain isolated and flat zigzag tetramers of Pn4(4-) (Pnictide (Pn) = As, Sb, Bi) with a conjugated pi-electron system of delocalized electrons. All six compounds are metallic ("metallic salts") and show temperature-independent (Pauli-like) paramagnetism due to a delocalized electron from the extra alkali-metal cation in the formula. At low temperatures (around 9.5 K) and low magnetic fields the bismuthides become superconducting.     

New pyrazolo[3,4-b]pyridones as selective A(1) adenosine receptor antagonists: synthesis, biological evaluation and molecular modelling studies

A series of ethyl 4-amino-1-(2-chloro-2-phenylethyl)-6-oxo-6,7-dihydro-1H-pyrazolo[3,4-b]pyridine-5-carboxylates () has been synthesized as potential A(1) adenosine receptor (A(1) AR) ligands. Binding affinities of the new compounds were determined for adenosine A(1), A(2A) and A(3) receptors. Compounds and showed good affinity (K(i)= 299 nM and 517 nM, respectively) and selectivity towards A(1) AR, whereas showed good affinity for A(2A) AR (K(i)= 290 nM), higher than towards A(1) AR (K(i)= 1000 nM). The only arylamino derivative of the series displayed high affinity (K(i)= 4.6 nM) and selectivity for A(3) AR. Molecular modelling and 3D-QSAR (CoMFA) studies carried out on the most active compounds gave further support to the pharmacological results.     

Unexpected formation of an azetidine-carborane derivative by dehydration of N-(1,12-dicarba-closo-dodecaboran-1-yl)formamide. The first X-ray structure of a 2,3-bis(imino)azetidine

Efforts to dehydrate (1,12-dicarba-closo-dodecaboran(12)-1-yl)formamide (a = 6.685(2) A, b = 12.877(4) A, c = 12.547(4) A, alpha = gamma = 90 degrees, beta = 90.724(11) degrees, V = 1080.8(6) A(3), Z = 4) resulted in the formation of a series of unexpected products. Addition of the Burgess reagent to the formamide, for example, led to the isolation of the corresponding methyl carbamate (a = 11.529(8) A, b = 11.529(8) A, c = 11.402(12) A, alpha = beta = gamma = 90 degrees, V = 1516(2) A(3), Z = 4), while treatment with triphosgene, a well-known dehydrating agent, resulted in the formation of a highly unusual 2,3-bis(p-carboranylimino)azetidine derivative. This particular compound, in the presence of Re(I), was hydrolyzed to give the corresponding amide, which is the first example of a 2,3-bis(imino)azetidine that has been characterized crystallographically (a = 38.496(13) A, b = 11.920(4) A, c = 27.523(10) A, beta = 127.050(5) degrees, V = 10079(6) A(3), Z = 8).     

Simultaneous determination of ascorbic acid,uric acid and dopamine at modified electrode based on hybrid nickel hexacyanoferrate/poly(1,5-diaminonaphthalene)

A novel modified electrode was fabricated by a mixed-valent nickel hexacyanoferrate (NiHCF) and poly 1,5-diaminonaphthalene (PDAN) hybrid at glassy carbon (GC) electrode. The obtained NiHCF/PDAN/GC modified electrode was characterized using cyclic voltammetry (CV) technique and scanning electron microscope (SEM). This electrode showed excellent catalytic properties toward the electrooxidation of ascorbic acid (A.A), dopamine (D.A) and uric acid (U.A) in 0.1 M NaCl solution using CV and square wave voltammetry (SWV) techniques. The NiHCF/PDAN/GC modified electrode exhibits high sensitivity, selectivity and stability making it a suitable sensor for the simultaneous detection of A.A, U.A and D.A in single and ternary mixture solutions. Different analytical parameters such as low detection limit (LOD), low quantification limit, correlation coefficient (R) and linear dynamic range were reported and discussed. The NiHCF/PDAN/GC modified electrode exhibits linear responses to A.A, D.A and U.A in the range 600–1000, 600–1000 and 600–1000 µM, respectively. The LOD for A.A, D.A and U.A were 0.036, 0.034 and 0.037 µM, respectively. The analytical behavior of this sensor had been evaluated for the detection of A.A and U.A in human serum and urine samples with satisfactory results.     

Rhenium(I) carbonyl complexes of 2,4,6-tris(2-pyridyl)-1,3,5-triazine (TPT). Rhenium(I)-promoted methoxylation of the triazine ring carbon atom in dinuclear rhenium complexes

2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4.     

Decomposition of dinuclear manganese complexes for the preparation of nanostructured oxide materials

The crystal structures of several dinuclear complexes of manganese are reported, and the decomposition and analysis of the nanostructured products derived from them are presented. 1,4,7,10-Tetraazacyclododecane (cyclen) forms dinuclear complexes 1-4 containing doubly oxo-bridged or oxo-acetato bridging ligands depending on the manganese salt used for the reaction. Doubly oxo-bridged 1 crystallizes in the orthorhombic space group Pnma, a = 22.3850(14) A, b = 9.1934(5) A, c = 13.2424(10) A, V = 2725.2(3) A(3). 2, containing [Mn(SCN)5](3-) conteranions, crystallizes in monoclinic space group I2/a with a = 18.2699(10) A, b = 11.2384(6) A, c = 18.6432(9) A, alpha = 90.00 degrees, beta = 114.510(6) degrees, gamma = 90.00 degrees, V = 3483.0(3) A(3). Oxo-acetato-bridged 3 crystallizes in orthorhombic space group Pca21, a = 13.9322(11) A, b = 16.2332(13) A, c = 14.6794(8) A, V = 3320.0(4) A(3). Compound 4 consists of a templated quasi-one-dimensional manganese oxalate crystallized in the triclinic space group P1, a = 9.5442(11) A, b = 10.3758(10) A, c = 21.851(2) A, alpha = 83.720(12) degrees, beta = 80.106(13) degrees, gamma = 85.457(13) degrees, V = 2114.9(4) A(3). Compounds 1, 3, and 4 decompose to nanostructured oxide materials, which may be isolated in bulk as lamellar-structured particles or microspheres or deposited on substrates.     

CASSCF and CASPT2 study on O- and Cl-loss predissociation mechanisms of OClO (A(2)A2)

For studying O- and Cl-loss predissociation mechanisms of OClO (A(2)A(2)), we calculated O- and Cl-loss dissociation potential energy curves (adiabatic minimum-energy dissociation paths) of several low-lying doublet and quartet states at the CASPT2 level and located the MECPs (minimum energy crossing points) for many pairs of the potential energy surfaces (PESs) at the CASPT2 and CASSCF levels. On the basis of our calculation results (including the spin-orbit couplings at the MECPs), we predict three processes for O-loss predissociation of A(2)A(2) and four processes for Cl-loss predissociation of A(2)A(2). The most favorable process for O-loss predissociation is OClO (A(2)A(2)) → A(2)A(2)/1 (2)B(2) MECP → 1 (2)B(2) (1 (2)A') → O ((3)P(g)) + ClO (X(2)Π) (the first O-loss limit), and the needed energy for this process from X(2)B(1) is 2.92 eV. The most favorable process for Cl-loss predissociation is OClO (A(2)A(2)) → A(2)A(2)/1 (2)B(2) MECP → TS1 (1 (2)B(2)) → 1 (2)B(2)/1 (2)A(1) MECP → Cl ((2)P(u)) + O(2) (X(3)Σ(g)(-)) (the first limit), and the needed energy is 3.08 eV. In the previously suggested mechanisms (processes), the A(2)A(2) state was considered to go to the important 1 (2)B(2) state via 1 (2)A(1) (A(2)A(2) → 1 (2)A(1) → 1 (2)B(2)). In the present study we have found that the A(2)A(2) state can directly go to 1 (2)B(2) (at the located A(2)A(2)/1 (2)B(2) MECP the CASPT2 energy (relative to X(2)B(1)) and CASSCF spin-orbit coupling are 2.92 eV and 61.3 cm(-1), respectively). We have compared our processes (A(2)A(2) → 1 (2)B(2) → ...) with the processes (A(2)A(2) → 1 (2)A(1) → 1 (2)B(2) → ...) suggested in the previous MRCI studies and rewritten by us using our calculation results. Energetically the MRCI process for O-loss predissociation (to the first limit) is only slightly (0.13 eV) more favorable than our process, and the MRCI processes for Cl-loss predissociation (to the first and second limits) need the same energies as our processes. By considering the probabilities of radiationless transitions, the MRCI processes are less favorable than our processes since the MRCI processes proceed via more PES/PES crossings (more MECPs). The experimental facts concerning the photodissociation are explained.     

Molten flux synthesis of an analogous series of layered alkali samarium selenogermanate compounds

In this work, we used the molten chalcogenide flux synthetic method to form an analogous series of alkali samarium selenogermanates, with the general formula ASmGeSe(4) (A = K, Rb, Cs). Using a constant reactant stoichiometry, we relate the monoclinic KLaGeSe(4) structure type to the orthorhombic CsSmGeS(4) structure type. KSmGeSe(4) [in space group P2(1) with cell parameters a = 6.774(1) A, b = 6.994(1) A, c = 8.960(2) A, beta = 108.225(3) degrees, and V = 403.2(1) A(3) (Z = 2)], RbSmGeSe(4) [in space group P2(1)2(1)2(1) with cell parameters a = 6.7347(8) A, b = 7.0185(9) A, c = 17.723(2) A, and V = 837.7(2) A(3) (Z = 4)], and CsSmGeSe(4) [in space group P2(1)2(1)2(1) with cell parameters a = 6.707(2) A, b = 7.067(2) A, c = 18.334(6) A, and V = 869.1(5) A(3) (Z = 4)] were formed under identical synthetic conditions by changing the identity of the alkali ion from K to Rb or Cs, respectively. Additionally, with the substitution of sodium into the reaction, a triclinic structure with the approximate formula NaSmGeSe(4) was found with the cell parameters a = 6.897(2) A, b = 9.919(2) A, c = 11.183(2) A, alpha = 84.067(4) degrees, beta = 88.105(4) degrees, gamma = 73.999(4) degrees, and V = 731.5(3) A(3). In addition to single-crystal diffraction, Raman and diffuse reflectance UV-visible spectroscopic measurements have been used to characterize these compounds.     

Syntheses, structures, and physical properties of LnAsTe (Ln = La, Pr, Sm, Gd, Dy, Er)

Six rare-earth arsenic tellurides have been synthesized by the reactions of the rare-earth elements (Ln) with As and Te at 1123 K. LaAsTe (a = 7.8354(11) A, b = 4.1721(6) A, c = 10.2985(14) A, T = 153 K), PrAsTe (a = 7.728(2) A, b = 4.1200(11) A, c = 10.137(3) A, T = 153 K), SmAsTe (a = 7.6180(16) A, b = 4.0821(9) A, c = 9.991(2) A, T = 153 K), GdAsTe (a = 7.5611(15) A, b = 4.0510(8) A, c = 9.920(2) A, T = 153 K), DyAsTe (a = 7.4951(13) A, b = 4.0246(7) A, c = 9.8288(17) A, T = 153 K), and ErAsTe (a = 7.4478(1) A, b = 4.0078(1) A, c = 9.7552(2) A, T = 153 K) crystallize with four formula units in the orthorhombic space group D2h16-Pnma. These compounds are isostructural and belong to the beta-ZrSb2 structure type. In each compound, the Ln atoms are coordinated by a tricapped trigonal prism of four As atoms and five Te atoms. The entire three-dimensional structure is built up by the motif of the LnAs4Te5 tricapped trigonal prisms. Infinite nonalternating zigzag As chains are found along the b axis, with As-As distances in these compounds ranging from 2.5915(5) to 2.6350(9) A. Conductivity measurements in the direction of these As chains indicate that PrAsTe is metallic whereas SmAsTe and DyAsTe are weakly metallic. Antiferromagnetic transitions occur in SmAsTe and DyAsTe at 3 and 9 K, respectively. DyAsTe above 9 K follows the Curie-Weiss law.     

Synthesis and characterization of zirconogermanates

Six new zirconogermanates have been prepared under hydrothermal conditions using amines as bases. There are four new structure types (ASU-n) with a common motif of ZrGe(5). ASU-23 is a layered structure: ZrGe(3)O(8)(OH)F.[C(10)H(26)N(4)].H(2)O, space group P2(1)/n, a = 6.7957(8) A, b = 12.700(1) A, c = 24.293(3) A, beta = 97.936(2) degrees, V = 2076.4(4) A(3). ASU-24 is a pillared layered structure: Zr(3)Ge(6)O(18)(OH(2),F)(4)F(2).[C(6)H(18)N(2)].[C(6)H(17)N(2)](2).2H(2)O, space group P2(1)/n, a = 7.4249(3) A, b = 25.198(1) A, c = 11.3483(5) A, beta = 90.995(1) degrees, V = 2122.9(2) A(3). This material has the lowest framework density (FD) of any oxide material that we are aware of (FD = 8.48 metal atoms/nm(3)). Two other materials form three-dimensional open-frameworks, ASU-25: ZrGe(3)O(9).[C(3)H(12)N(2)], space group P112(1)/a, a = 13.1994(4) A, b = 7.6828(2) A, c = 11.2373(3) A, gamma = 91.233(3) degrees, V = 1139.29(5) A(3). The other is ASU-26: ZrGe(3)O(9).[C(2)H(10)N(2)], space group Pn, a = 13.7611(3) A, b = 7.7294(2) A, c = 11.2331(3) A, beta = 104.793(1) degrees, V = 1155.21(4) A(3). ASU-25 is related to the mineral umbite K(2)ZrSi(3)O(9).H(2)O. The germanium equivalent has been prepared through the inorganic route: K(2)ZrGe(3)O(9).H(2)O, space group P2(1)2(1)2(1), a = 13.6432(6) A, b = 7.4256(3) A, c = 10.3973(4) A, V = 1053.33(8) A(3). The structural relationships between ASU-25 and its inorganic counterpart are described. The thermal decomposition of the germanium umbite generated the cyclic trigermanate K(2)ZrGe(3)O(9), analogue of the mineral wadeite, crystallizing in the orthorhombic system, a = 7.076 A, b = 12.123 A, c = 10.451 A, V = 904.5 A(3).     

Triterpene glycosides from the sea cucumber Eupentacta fraudatrix. Structure and cytotoxic action of cucumariosides A2, A7, A9, A10, an, A13 and A14, seven new minor non-sulfated tetraosides and an aglycone with an uncommon 18-hydroxy group

Seven new minor triterpene glycosides, cucumariosides A2 (1), A7 (2), A9 (3), A10 (4), A11 (5), A13 (6) and A14 (7) have been isolated from the Far Eastern sea cucumber Eupentacta fraudatrix. Structures of the glycosides were elucidated by 2D NMR spectroscopy and MS. Glycosides 1-7 belong to the group of cucumariosides A, having linear tetrasaccharide carbohydrate moieties without any sulfate group and possessing 3-O-methyl-D-xylose as a terminal monosaccharide unit. Glycosides 1, 2, 5-7 differ from each other in side chain structures in aglycone moieties, while cucumarioside A10 (4) has a 23,24,25,26,27-pentanorlanostane aglycone with 18(16)-lactone. Cucumarioside A9 (3), having an uncommon 18-hydroxy group, is the second representative of the unique metabolically active glycosides that are regarded as intermediates of glycoside biosynthesis in sea cucumbers. Cytotoxic activities of glycosides 1-7 and cucumarioside A8 (8) against mouse spleen lymphocytes and the cells of the ascite form of mouse Ehrlich carcinoma, along with hemolytic activity against mouse erythrocytes and antifungal activity were studied. Cucumariosides A2 (1), A8 (8) and A13 (6) demonstrated high hemolytic activities. Glycosides 1, 4 and 6 showed moderate cytotoxic activity. Only cucumarioside A8 (8), having an 18-oxymethylene group and a 24(25)-double bond, was very active in all the tests.     

Homonuclear transition-metal trimers

Density-functional theory has been used to determine the ground-state geometries and electronic states for homonuclear transition-metal trimers constrained to equilateral triangle geometries. This represents the first application of consistent theoretical methods to all of the ten 3d block transition-metal trimers, from scandium to zinc. A search of the potential surfaces yields the following electronic ground states and bond lengths: Sc3(2A1',2.83 A), Ti3(7E',2.32 A), V3(2E",2.06 A), Cr3(17E',2.92 A), Mn3(16A2',2.73 A), Fe3(11E",2.24 A), Co3(6E",2.18 A), Ni3(3A2",2.23 A), Cu3(2E',2.37 A), and Zn3(1A1',2.93 A). Vibrational frequencies, several low-lying electronic states, and trends in bond lengths and atomization energies are discussed. The predicted dissociation energies DeltaE(M3-->M2+M) are 49.4 kcal mol(-1)(Sc3), 64.3 kcal mol(-1)(Ti3), 60.7 kcal mol(-1)(V3), 11.5 kcal mol(-1)(Cr3), 32.4 kcal mol(-1)(Mn3), 61.5 kcal mol(-1)(Fe3), 78.0 kcal mol(-1)(Co3), 86.1 kcal mol(-1)(Ni3), 26.8 kcal mol(-1)(Cu3), and 4.5 kcal mol(-1)(Zn3).     

Relationship between the broad OH stretching band of methanol and hydrogen-bonding patterns in the liquid phase

The OH stretching (nu(OH)) band of methanol observed in condensed phase has been analyzed in terms of hydrogen-bonding patterns. Quantum chemical calculations for methanol clusters have revealed that broadening of the nu(OH) envelope is reasonably reproduced by considering nearest and next-nearest neighbor interactions through hydrogen bonding. Because the hydrogen bond formed between donor (D) and acceptor (A) is cooperatively strengthened or weakened by a newly formed hydrogen bond at D or A, we have proposed the following notation for hydrogen-bonding patterns of monohydric alcohols: a(D)DAd(A)a(A), where a is the number of protons accepted by D (a(D)) or A (a(A)), and d(A) is the number of protons donated by A. The indicator of the hydrogen-bond strength, which is given by M(OH) = a(D) + d(A) - a(A), is correlated well with the nu(OH) wavenumber of the methanol molecule D participating in the a(D)DAd(A)a(A) pattern. The correlation between M(OH) and the hydrogen-bonding energy of the a(D)DAd(A)a(A) pattern has also been deduced from the calculation results for the clusters. The nu(OH) bands of methanol measured in the CCl4 solution and pure liquid have been successfully analyzed by the method proposed here.     

Synthesis, structure, and multi-NMR studies of (Me4N)[A(M(SC(O)Ph)3)2] (A = Na, M = Hg; A = K, M = Cd or Hg)

The compounds (Me4N)[A(M(SC(O)Ph)3)2] (A = K, M = Cd (2); A = Na, M = Hg (3); and A = K, M = Hg (4)) were synthesized by reacting the appropriate metal chloride with A+PhC(O)S- and Me4NCl in the ratios 1:3:1 and 2:6:1. The structures of these compounds were determined by single-crystal X-ray diffraction methods. All the compounds are isomorphous, isostructural, and crystallized in the space group P1 with Z = 1. Single-crystal data for 2: a = 106670(2) A, b = 111522(2) A, c = 119294(2) A, alpha = 71782(1) degrees, beta = 85208(1) degrees, gamma = 69418(1) degrees, V = 126140(4) A3, Dcalc = 1528 g cm-3. Single-crystal data for 3: a = 10840(2) A, b = 10946(4) A, c = 12006(3) A, alpha = 7218(2) degrees, beta = 8675(2) degrees, gamma = 6743(2) degrees, V = 12493(6) A3, Dcalc = 1756 g cm-3. Single-crystal data for 4: a = 104780(1) A, b = 112563(2) A, c = 119827(2) A, alpha = 71574(1) degrees, beta = 85084(1) degrees, gamma = 70705(1) degrees, V = 126523(3) A3, Dcalc = 1755 g cm-3. In the [A(M(SC(O)Ph)3)2]- anions, each M(II) atom is bonded to three thiobenzoate ligands through sulfur atoms, giving a trigonal planar MS3 geometry. The carbonyl oxygen atoms from the two [M(SC(O)Ph)3]- anions are bonded to the alkali metal atom, providing an octahedral environment. Solution metal NMR studies showed the concentration-dependent dissociation of the alkali metal ions in the trinuclear anions.     

Multigram-scale syntheses, stability, and photoreactions of A2A adenosine receptor antagonists with 8-styrylxanthine structure: potential drugs for Parkinson's disease

The improved multigram-scale syntheses of the important 8-styrylxanthine A(2A) adenosine receptor antagonist MSX-2 (8), its water-soluble prodrug MXS-3 (9), and KW-6002 (16) are described. N-Alkylation reactions at different positions of uracil derivatives were optimized. Two different methods for xanthine formation from 6-amino-5-cinnamoylaminouracil precursors were investigated, (a) the elimination of water by alkaline catalysis and (b) hexamethyldisilazane as a condensing agent; the latter was found to be superior. The photosensitivity of 8-styrylxanthines was studied. The (E)-configurated stryrylxanthine MSX-2 (8) isomerized in diluted solution, and the resulting (Z)-isomer (10a) was isolated and characterized. Furthermore, we describe for the first time that solid 8-styrylxanthines can dimerize upon exposition to daylight or irradiation with UV light. The resulting cyclobutane derivatives with head-to-tail (syn) configuration exhibited a considerably lower A(2A) adenosine receptor affinity than their parent compounds. The dimerization product of MSX-2 was a moderately potent nonselective A(1) and A(2A) antagonist (K(i)(A(1)) = 273 nM, K(i) (A(2A)) = 175 nM) while the dimer of the related compound KW-6002 was inactive at A(1) and only weakly active at A(2A) adenosine receptors (K(i) = 1.57 microM). The light sensitivity of 8-styrylxanthine derivatives, not only in solution, but also in the solid state, has to be considered when using those compounds as pharmacological tools or drugs.     

Syntheses and characterization of anti-inflammatory dinuclear and mononuclear zinc indomethacin complexes. Crystal structures of [Zn2(indomethacin)4(L)2] (L = N,N-dimethylacetamide, pyridine, 1-methyl-2-pyrrolidinone) and [Zn(indomethacin)2(L1)2] (L1 = ethanol, methanol)

The syntheses and spectral and structural characterizations of Zn(II) indomethacin [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic acid = IndoH] complexes, as different solvent adducts, have been studied. The complexes are unusual in that both monomeric and dimeric complexes are formed and that this is the first example of the same carboxylato ligand binding via both carboxylate oxygen atoms in monomeric and dimeric Zn(II) complexes. The crystal structures of Zn-Indo complexes with N,N-dimethylacetamide (DMA), pyridine (Py), 1-methyl-2-pyrrolidinone (NMP), EtOH, and MeOH as solvent ligands, [Zn2(Indo)4(DMA)2].2DMA, 1, [Zn2(Indo)4(Py)2].2H2O, 2b, [Zn2(Indo)4(NMP)2], 3, cis-[Zn(Indo)2(EtOH)2], 4, and cis-[Zn(Indo)2(MeOH)2], 5, were determined. Complexes 1, 2b, and 3 crystallize in the triclinic space group P1 (No. 2): a = 13.628(2) A, b = 17.462(2) A, c = 11.078(1) A, alpha = 99.49(1) degrees, beta = 108.13(1) degrees, gamma = 110.10(1) degrees for 1; a = 13.347(3) A, b = 16.499(5) A, c = 10.857(1) A, alpha = 99.48(2) degrees, beta = 108.25(2) degrees, gamma = 106.24(2) degrees for 2; a = 14.143(3) A, b = 14.521(2) A, c = 11.558(2) A, alpha = 109.07(1) degrees, beta = 90.80(2) degrees, gamma = 116.40(1) degrees for 3. The three complexes exhibit dinuclear paddle-wheel structures with a Zn...Zn distance of 2.9686(6) A, Zn-ORCOO distances of 2.035(2)-2.060(2) A, and a Zn-ODMA distance of 1.989(2) A in 1, a Zn...Zn distance of 2.969(1) A, Zn-ORCOO distances of 2.020(3)-2.049(3) A, and a Zn-NPy distance of 2.036(3) A in 2, and a Zn...Zn distance of 2.934(1) A, Zn-ORCOO distances of 2.009(3)-2.051(3) A, and a Zn-ONMP distance of 1.986(3) A in 3. In these cases, the zinc ions are offset along the z direction such that the L-Zn...Zn-L moiety is nonlinear, unlike the Cu analogues. Each Zn has a square-pyramidal geometry bridged by four carboxylato ligands in the basal plane with the solvent ligands containing an O- or N-donor atom at the apex. Complexes 4 and 5 are isostructural, with space group C2/c (No. 15). For 4, a = 30.080(2) A, b = 5.3638(6) A, c = 24.739(2) A, beta = 90.342(7) degrees, and for 5, a = 29.419(2) A, b = 5.320(2) A, c = 24.461(2) A, beta = 90.840(4) degrees. The Zn resides on a 2-fold axis and the complexes have a distorted cis octahedral structure with Zn-ORCOO bond lengths of 2.183(3) and 2.169(3) A, a Zn-OEtOH bond length of 2.015(3) A in 4, Zn-ORCOO bond lengths of 2.195(2) and 2.151(2) A, and a Zn-OMeOH bond length of 2.022(3) A in 5.     

Stabilization of new forms of the intermetallic phases beta-RENiGe2 (RE = Dy, Ho, Er, Tm, Yb, Lu) in liquid indium

Flux conditions using liquid indium bypass the thermodynamically stable structure and yield new forms of the phases RENiGe2 (RE = Dy, Er, Yb, Lu). The compounds crystallize in the orthorhombic Immm space group and possess the YIrGe2 structure type. Lattice parameters for ErNiGe2, DyNiGe2, YbNiGe2, and LuNiGe2 are a = 4.114(1) A, b = 8.430(2) A, c = 15.741(5) A; a = 4.1784(9) A, b = 8.865(2) A, c = 15.745(3) A; a = 4.0935(6) A, b = 8.4277(13) A, c = 15.751(2) A, and a = 4.092(1) A, b = 8.418(3) A, c = 15.742(5) A, respectively. These phases represent a new structural arrangement (beta) of the compound type RENiGe2 as another set of compounds with identical stoichiometry are known to adopt the orthorhombic Cmcm CeNiSi2 type structure (alpha). In this paper we report the crystal and electronic band structure of four new members of the YIrGe2 structure type, as well as an investigation of the relative thermodynamic stabilities of the two forms.